CAS: 96315-11-6 | Tetramethyl 5-formyl-5'-methylbis-(2-aminophenoxy-methylene)-N,N,N',N'-tetraacetate, NX71371
SKU: NX71371-10MG
Product Identifiers
| Catalog # | NX71371 |
| CAS Number | 96315-11-6 |
| PubChem CID | 2735438 |
| Chemical Name | Tetramethyl 5-formyl-5'-methylbis-(2-aminophenoxy-methylene)-N,N,N',N'-tetraacetate |
| IUPAC Name | methyl 2-[2-[2-[2-[bis(2-methoxy-2-oxoethyl)amino]-5-formylphenoxy]ethoxy]-N-(2-methoxy-2-oxoethyl)-4-methylanilino]acetate |
| Synonym | BAPTA-TMFM |
| InChI | InChI=1S/C28H34N2O11/c1-19-6-8-21(29(14-25(32)36-2)15-26(33)37-3)23(12-19)40-10-11-41-24-13-20(18-31)7-9-22(24)30(16-27(34)38-4)17-28(35)39-5/h6-9,12-13,18H,10-11,14-17H2,1-5H3 |
| InChIKey | GKTVRWOCZLYLJV-UHFFFAOYSA-N |
| SMILES | COC(=O)CN(CC(=O)OC)c1ccc(C)cc1OCCOc2cc(C=O)ccc2N(CC(=O)OC)CC(=O)OC |
| MDL Number | MFCD00291363 |
Specification
| MW | 574.6 |
| MF | C28H34N2O11 |
| Product Notes | A new fluorescent chelating indicator to study the physiological role of cytosolic free Calcium. |
| Cat Number | OR1275T |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
