CAS: 938-55-6 | 6-(Dimethylamino)purine, NX69883
SKU: NX69883-10G
Product Identifiers
| Catalog # | NX69883 |
| CAS Number | 938-55-6 |
| EC Numberr | 213-344-3 |
| PubChem CID | 3134 |
| Chemical Name | 6-(Dimethylamino)purine |
| IUPAC Name | N,N-dimethyl-7H-purin-6-amine |
| Synonym | N6,N6-Dimethyladenine |
| InChI | InChI=1S/C7H9N5/c1-12(2)7-5-6(9-3-8-5)10-4-11-7/h3-4H,1-2H3,(H,8,9,10,11) |
| InChIKey | BVIAOQMSVZHOJM-UHFFFAOYSA-N |
| SMILES | CN(C)c1ncnc2nc[nH]c12 |
| MDL Number | MFCD00005573 |
Specification
| MW | 163.18 |
| MF | C7H9N5 |
| Product Notes | Inhibitor of protein and cyclin-dependent kinases. |
| Special Remarks | Store at -15¡C |
| Cat Number | BIB1476 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
