CAS: 91-95-2 | 3,3'-Diaminobenzidine, NX68214
SKU: NX68214-5G
Product Identifiers
| Catalog # | NX68214 |
| CAS Number | 91-95-2 |
| EC Numberr | 202-110-6 |
| PubChem CID | 7071 |
| Chemical Name | 3,3'-Diaminobenzidine |
| IUPAC Name | 4-(3,4-diaminophenyl)benzene-1,2-diamine |
| Synonym | 3,3',4,4'-Biphenyltetramine, DAB |
| InChI | InChI=1S/C12H14N4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H,13-16H2 |
| InChIKey | HSTOKWSFWGCZMH-UHFFFAOYSA-N |
| SMILES | Nc1ccc(cc1N)c2ccc(N)c(N)c2 |
| MDL Number | MFCD00007725 |
Specification
| MW | 214.27 |
| MF | C12H14N4 |
| Product Notes | Substrate for peroxidase. Also can be used fordetermination of selenium |
| Special Remarks | Store at 2-8¡C |
| Cat Number | BID2042 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
