CAS: 827-15-6 | Iodopentafluorobenzene, >99%, NX62980
SKU: NX62980-5G
Product Identifiers
Catalog # | NX62980 |
CAS Number | 827-15-6 |
EC Numberr | 212-565-2 |
PubChem CID | 70008 |
Chemical Name | Iodopentafluorobenzene |
IUPAC Name | 1,2,3,4,5-pentafluoro-6-iodobenzene |
Synonym | Pentafluoroiodobenzene, 1-Iodo-2,3,4,5,6-pentafluorobenzene, Perfluoroiodobenzene |
InChI | InChI=1S/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
InChIKey | OPYHNLNYCRZOGY-UHFFFAOYSA-N |
SMILES | Fc1c(F)c(F)c(I)c(F)c1F |
MDL Number | MFCD00001032 |
Specification
MW | 293.96 |
MF | C6F5I |
Assay | >99% |
Special Remarks | Stabilised with copper |
Cat Number | PC4930 |
Manufacturer | Apollo Scientific |
Country of Origin | United Kingdom |