CAS: 64-75-5 | Tetracycline hydrochloride, NX56453
SKU: NX56453-25G
Product Identifiers
| Catalog # | NX56453 |
| CAS Number | 64-75-5 |
| EC Numberr | 200-593-8 |
| PubChem CID | 139023972 |
| Chemical Name | Tetracycline hydrochloride |
| IUPAC Name | (4S,4aS,5aS,6S,12aS)-4-(dimethylamino)-6,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
| InChI | InChI=1S/C22H24N2O8.ClH/c1-21(31)8-5-4-6-11(25)12(8)16(26)13-9(21)7-10-15(24(2)3)17(27)14(20(23)30)19(29)22(10,32)18(13)28;/h4-6,9-10,13-15,25,31-32H,7H2,1-3H3,(H2,23,30);1H/t9-,10-,13?,14?,15-,21+,22-;/m0./s1 |
| InChIKey | JCBQYRBTRRPKMO-PMMNLZCOSA-N |
| SMILES | Cl.CN(C)[C@H]1[C@@H]2C[C@H]3C(C(=O)c4c(O)cccc4[C@@]3(C)O)C(=O)[C@]2(O)C(=O)C(C(=O)N)C1=O |
| MDL Number | MFCD00078142 |
Specification
| MW | 480.9 |
| MF | C22H25ClN2O8 |
| Product Notes | Cell culture tested Tetracycline is a bacteriostatic antibiotic with activity against gram-positive and gram-negative bacteria. |
| Special Remarks | Store at -20¡C |
| Cat Number | BIT0150 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
