CAS: 598-73-2 | Bromotrifluoroethylene, >98%, NX54390
SKU: NX54390-25G
Product Identifiers
| Catalog # | NX54390 |
| CAS Number | 598-73-2 |
| EC Numberr | 209-948-1 |
| PubChem CID | 11730 |
| Chemical Name | Bromotrifluoroethylene |
| IUPAC Name | 1-bromo-1,2,2-trifluoroethene |
| Synonym | 1-Bromo-1,2,2-trifluoroethene |
| InChI | InChI=1S/C2BrF3/c3-1(4)2(5)6 |
| InChIKey | AYCANDRGVPTASA-UHFFFAOYSA-N |
| SMILES | FC(=C(F)Br)F |
| MDL Number | MFCD00039271 |
Specification
| MW | 160.92 |
| MF | C2BrF3 |
| Assay | >98% |
| Special Remarks | Inhibited with tributylamine. Cylinder - 1/4" NPT connection. |
| Cat Number | PC1590 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
