CAS: 13695-31-3 | 1H,1H-Perfluorobutyl methacrylate, >97%, NX22444
SKU: NX22444-10G
Product Identifiers
| Catalog # | NX22444 |
| CAS Number | 13695-31-3 |
| EC Numberr | 237-217-7 |
| PubChem CID | 83666 |
| Chemical Name | 1H,1H-Perfluorobutyl methacrylate |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-methylprop-2-enoate |
| Synonym | 2,2,3,3,4,4,4-Heptafluorobutyl methacrylate |
| InChI | InChI=1S/C8H7F7O2/c1-4(2)5(16)17-3-6(9,10)7(11,12)8(13,14)15/h1,3H2,2H3 |
| InChIKey | VIEHKBXCWMMOOU-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)F |
| MDL Number | MFCD00039251 |
Specification
| MW | 268.13 |
| MF | C8H7F7O2 |
| Assay | >97% |
| Special Remarks | Stabilised with 20-50 ppm hydroquinone |
| Cat Number | PC11102 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
