CAS: 10344-94-2 | 4-Nitrophenyl-beta-D-glucuronide, >99%, NX11954
SKU: NX11954-250MG
Product Identifiers
| Catalog # | NX11954 |
| CAS Number | 10344-94-2 |
| EC Numberr | 233-753-0 |
| PubChem CID | 82565 |
| Chemical Name | 4-Nitrophenyl-beta-D-glucuronide |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(4-nitrophenoxy)oxane-2-carboxylic acid |
| Synonym | NPG |
| InChI | InChI=1S/C12H13NO9/c14-7-8(15)10(11(17)18)22-12(9(7)16)21-6-3-1-5(2-4-6)13(19)20/h1-4,7-10,12,14-16H,(H,17,18)/t7-,8-,9+,10-,12+/m0/s1 |
| InChIKey | QSUILVWOWLUOEU-GOVZDWNOSA-N |
| SMILES | O[C@@H]1[C@@H](O)[C@H](Oc2ccc(cc2)[N+](=O)[O-])O[C@@H]([C@H]1O)C(=O)O |
| MDL Number | MFCD00036210 |
Specification
| MW | 315.23 |
| MF | C12H13NO9 |
| Assay | >99% |
| Product Notes | NPG is a spectrophotometric substrate forb-Glucuronidase activity. NPG is cleaved by GUSvia hydrolysation at the 1-glycosidic bond between4-nitrophenol and glucuronic acid. |
| Special Remarks | Store at 2-8¡C |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
