CAS: 926921-63-3 | 4-Isocyanato-4-(thien-2-yl)tetrahydro-2H-pyran, >95%, NX69211
SKU: NX69211-250MG
Product Identifiers
| Catalog # | NX69211 |
| CAS Number | 926921-63-3 |
| PubChem CID | 24229667 |
| Chemical Name | 4-Isocyanato-4-(thien-2-yl)tetrahydro-2H-pyran |
| IUPAC Name | 4-isocyanato-4-thiophen-2-yloxane |
| Synonym | 4-(Thien-2-yl)tetrahydro-2H-pyran-4-yl isocyanate, 2-(4-Isocyanatotetrahydro-2H-pyran-4-yl)thiophene |
| InChI | InChI=1S/C10H11NO2S/c12-8-11-10(3-5-13-6-4-10)9-2-1-7-14-9/h1-2,7H,3-6H2 |
| InChIKey | CDJWJYYYKMFRFC-UHFFFAOYSA-N |
| SMILES | O=C=NC1(CCOCC1)c2cccs2 |
| MDL Number | MFCD09879931 |
Specification
| MW | 209.27 |
| MF | C10H11NO2S |
| Assay | >95% |
| Product Notes | When melted, may contain small amount of sediment |
| Cat Number | OR14870 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
