CAS: 774-73-2 | 2,4-Difluorocinnamic acid, NX61567
SKU: NX61567-10G
Product Identifiers
| Catalog # | NX61567 |
| CAS Number | 774-73-2 |
| PubChem CID | 5374945 |
| Chemical Name | 2,4-Difluorocinnamic acid |
| IUPAC Name | (E)-3-(2,4-difluorophenyl)prop-2-enoic acid |
| Synonym | 3-(2,4-Difluorophenyl)prop-2-enoic acid, 3-(2,4-Difluorophenyl)acrylic acid |
| InChI | InChI=1S/C9H6F2O2/c10-7-3-1-6(8(11)5-7)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
| InChIKey | PQDXPFJQTKGTFP-DUXPYHPUSA-N |
| SMILES | OC(=O)\C=C\c1ccc(F)cc1F |
| MDL Number | MFCD00010317 |
Specification
| MW | 184.14 |
| MF | C9H6F2O2 |
| Special Remarks | Mixture of cis/trans isomers |
| Cat Number | PC49232 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
