CAS: 6112-76-1 | 6-Mercaptopurine monohydrate, NX54956
SKU: NX54956-5G
Product Identifiers
| Catalog # | NX54956 |
| CAS Number | 6112-76-1 |
| PubChem CID | 2724350 |
| Chemical Name | 6-Mercaptopurine monohydrate |
| IUPAC Name | 3,7-dihydropurine-6-thione;hydrate |
| Synonym | 1,7-Dihydro-6H-purine-6-thione hydrate |
| InChI | InChI=1S/C5H4N4S.H2O/c10-5-3-4(7-1-6-3)8-2-9-5;/h1-2H,(H2,6,7,8,9,10);1H2 |
| InChIKey | WFFQYWAAEWLHJC-UHFFFAOYSA-N |
| SMILES | O.S=C1NC=Nc2nc[nH]c12 |
| MDL Number | MFCD03854445 |
Specification
| MW | 170.2 |
| MF | C5H6N4OS |
| Product Notes | 6-Mercaptopurine is an antineoplastic agent which acts asan antimetabolite. It is an analogue of the natural purines hypoxanthine and adenine |
| Special Remarks | Store at 0-5¡C |
| Cat Number | BIM0129 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
