CAS: 16063-80-2 | 4,4,4,4',4',4'-Hexafluoro-DL-valine, >97%, NX27046
SKU: NX27046-250MG
Product Identifiers
| Catalog # | NX27046 |
| CAS Number | 16063-80-2 |
| EC Numberr | 240-207-5 |
| PubChem CID | 85954 |
| Chemical Name | 4,4,4,4',4',4'-Hexafluoro-DL-valine |
| IUPAC Name | 2-amino-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid |
| Synonym | 2-Amino-4,4,4-trifluoro-3-(trifluoromethyl)butanoic acid, 2-Amino-4,4,4-trifluoro-3-(trifluoromethyl)butyric acid |
| InChI | InChI=1S/C5H5F6NO2/c6-4(7,8)2(5(9,10)11)1(12)3(13)14/h1-2H,12H2,(H,13,14) |
| InChIKey | KRNSHCKTGFAMPQ-UHFFFAOYSA-N |
| SMILES | NC(C(C(F)(F)F)C(F)(F)F)C(=O)O |
| MDL Number | MFCD00014349 |
Specification
| MW | 225.09 |
| MF | C5H5F6NO2 |
| Assay | >97% |
| Product Notes | J. Med. Chem., 30, 1097 (1987): Synthesis of fluorinated analogues of angiotensin II. Russ. Chem. Rev., 60, 850 (1991): A review of aliphatic fluorine-containing amino-acids. |
| Cat Number | PC4810 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
