CAS: 1513-65-1 | 2,6-Difluoropyridine, >98%, NX25658
SKU: NX25658-25G
Product Identifiers
| Catalog # | NX25658 |
| CAS Number | 1513-65-1 |
| EC Numberr | 216-152-8 |
| PubChem CID | 73934 |
| Chemical Name | 2,6-Difluoropyridine |
| IUPAC Name | 2,6-difluoropyridine |
| InChI | InChI=1S/C5H3F2N/c6-4-2-1-3-5(7)8-4/h1-3H |
| InChIKey | MBTGBRYMJKYYOE-UHFFFAOYSA-N |
| SMILES | Fc1cccc(F)n1 |
| MDL Number | MFCD00006227 |
Specification
| MW | 115.08 |
| MF | C5H3F2N |
| Assay | >98% |
| Product Notes | J. Chem. Soc., Perkin 1, 423 (1998): Sequential elimination of the fluorine atoms with nitrogen has resulted in the synthesis of linear and macrocyclic ligands. |
| Cat Number | PC2886 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
