CAS: 132-98-9 | Penicillin V potassium, NX20970
SKU: NX20970-5G
Product Identifiers
| Catalog # | NX20970 |
| CAS Number | 132-98-9 |
| EC Numberr | 205-086-5 |
| PubChem CID | 23676814 |
| Chemical Name | Penicillin V potassium |
| IUPAC Name | potassium;(2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenoxyacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| Synonym | Phenoxymethylpenicillin K+ salt |
| InChI | InChI=1S/C16H18N2O5S.K/c1-16(2)12(15(21)22)18-13(20)11(14(18)24-16)17-10(19)8-23-9-6-4-3-5-7-9;/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);/q;+1/p-1/t11-,12+,14-;/m1./s1 |
| InChIKey | HCTVWSOKIJULET-LQDWTQKMSA-M |
| SMILES | [K+].CC1(C)S[C@@H]2[C@H](NC(=O)COc3ccccc3)C(=O)N2[C@H]1C(=O)[O-] |
| MDL Number | MFCD00051771 |
Specification
| MW | 388.5 |
| MF | C16H17KN2O5S |
| Product Notes | Potency: 1650mg/mgPenicillin V is an inhibitor of bacterial cell wall synthesisActive against gram-positive and some gram-negative bacteria. b-lactamase sensitive |
| Special Remarks | Store at 2-8¡C |
| Cat Number | BIP0143 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
