CAS: 123984-00-9 | Collagenase Inhibitor (MMP1), NX18591
SKU: NX18591-50MG
Product Identifiers
| Catalog # | NX18591 |
| CAS Number | 123984-00-9 |
| PubChem CID | 11113112 |
| Chemical Name | Collagenase Inhibitor (MMP1) |
| IUPAC Name | benzyl (2S)-2-[[(2S)-1-[[(2S)-1-(hydroxyamino)-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]pyrrolidine-1-carboxylate |
| Synonym | Z-Pro-Leu-Ala-NHOH |
| InChI | InChI=1S/C22H32N4O6/c1-14(2)12-17(20(28)23-15(3)19(27)25-31)24-21(29)18-10-7-11-26(18)22(30)32-13-16-8-5-4-6-9-16/h4-6,8-9,14-15,17-18,31H,7,10-13H2,1-3H3,(H,23,28)(H,24,29)(H,25,27)/t15-,17-,18-/m0/s1 |
| InChIKey | FAGYGQYGBIUTAJ-SZMVWBNQSA-N |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]1CCCN1C(=O)OCc2ccccc2)C(=O)N[C@@H](C)C(=O)NO |
| MDL Number | MFCD00238505 |
Specification
| MW | 448.5 |
| MF | C22H32N4O6 |
| Product Notes | A highly specific and potent inhibitor of vertebrate collagenases with IC50 values in the order of 10-6M. IC50: 10-6 Collagenase; human skin and pollywog. Stable at -20¡C for 12 months. |
| Special Remarks | Store at -20¡C |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
