CAS: 122320-73-4 | Rosiglitazone, NX18084
SKU: NX18084-10MG
Product Identifiers
| Catalog # | NX18084 |
| CAS Number | 122320-73-4 |
| PubChem CID | 77999 |
| Chemical Name | Rosiglitazone |
| IUPAC Name | 5-[[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| Synonym | BRL-49653 |
| InChI | InChI=1S/C18H19N3O3S/c1-21(16-4-2-3-9-19-16)10-11-24-14-7-5-13(6-8-14)12-15-17(22)20-18(23)25-15/h2-9,15H,10-12H2,1H3,(H,20,22,23) |
| InChIKey | YASAKCUCGLMORW-UHFFFAOYSA-N |
| SMILES | CN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)c3ccccn3 |
| MDL Number | MFCD00871760 |
Specification
| MW | 357.4 |
| MF | C18H19N3O3S |
| Product Notes | Rosiglitazone is a selective agonist of PPAR with EC50 of 60 nM and has no effect on PPAR and PPAR It is an insulin sensitizing and potent antihyperglycemic agent |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
