CAS: 1029880-18-9 | 3-Fluoropyridine-4-boronic acid hydrate, NX11741
SKU: NX11741-1G
Product Identifiers
| Catalog # | NX11741 |
| CAS Number | 1029880-18-9 |
| PubChem CID | 2779352 |
| Chemical Name | 3-Fluoropyridine-4-boronic acid hydrate |
| IUPAC Name | (3-fluoropyridin-4-yl)boronic acid;hydrate |
| InChI | InChI=1S/C5H5BFNO2.H2O/c7-5-3-8-2-1-4(5)6(9)10;/h1-3,9-10H;1H2 |
| InChIKey | MESGEMIQUNLQHJ-UHFFFAOYSA-N |
| SMILES | O.OB(O)c1ccncc1F |
| MDL Number | MFCD03701686 |
Specification
| MW | 158.93 |
| MF | C5H7BFNO3 |
| Product Notes | In Suzuki biaryl coupling displacement of boron by an electrophilic species takes place with the formation of a new carbon-carbon or carbon-heteroatom bond. |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
