CAS: 98063-21-9 | (R)-Aminocarnitine, NX71606
SKU: NX71606-5MG
Product Identifiers
| Catalog # | NX71606 |
| CAS Number | 98063-21-9 |
| PubChem CID | 92043588 |
| Chemical Name | (R)-Aminocarnitine |
| IUPAC Name | (2R,3S)-2-amino-3-hydroxy-4-(trimethylazaniumyl)butanoate |
| InChI | InChI=1S/C7H16N2O3/c1-9(2,3)4-5(10)6(8)7(11)12/h5-6,10H,4,8H2,1-3H3/t5-,6+/m0/s1 |
| InChIKey | RKNHTGDLNNBLGZ-NTSWFWBYSA-N |
| SMILES | C[N+](C)(C)C[C@H](O)[C@@H](N)C(=O)[O-] |
| MDL Number | MFCD00797591 |
Specification
| MW | 176.21 |
| MF | C7H16N2O3 |
| Product Notes | Inhibits fatty acid oxidation. Acts as a hypoglycemic and antiketogenic compound and alterslipidic metabolism inhibiting carnitine acetyltransferase (CAT) and carnitinepalmitoyltransferase (CPT) |
| Cat Number | OR0340T |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
