CAS: 73413-79-3 | Camphorquinone-10-sulphonic acid hydrate, NX60002
SKU: NX60002-100MG
Product Identifiers
| Catalog # | NX60002 |
| CAS Number | 73413-79-3 |
| PubChem CID | 46780160 |
| Chemical Name | Camphorquinone-10-sulphonic acid hydrate |
| IUPAC Name | (7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;hydrate |
| Synonym | (7,7-Dimethyl-2,3-dioxobicyclo[2.2.1]hept-1-yl)methanesulphonic acid hydrate, CQS-OH |
| InChI | InChI=1S/C10H14O5S.H2O/c1-9(2)6-3-4-10(9,5-16(13,14)15)8(12)7(6)11;/h6H,3-5H2,1-2H3,(H,13,14,15);1H2 |
| InChIKey | YEGBEDZBQAKLIO-UHFFFAOYSA-N |
| SMILES | O.CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2=O |
| MDL Number | MFCD00269942 |
Specification
| MW | 264.3 |
| MF | C10H16O6S |
| Product Notes | A crystalline water-soluble reagent useful for specific, reversible modification of the guanidino group of arginine residues. Suitable for use with small arginine-containing molecules. |
| Cat Number | OR7300T |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
