CAS: 71217-46-4 | 5-(Isocyanatomethyl)-1,3-benzodioxole, >97%, NX59270
SKU: NX59270-250MG
Product Identifiers
| Catalog # | NX59270 |
| CAS Number | 71217-46-4 |
| PubChem CID | 15932354 |
| Chemical Name | 5-(Isocyanatomethyl)-1,3-benzodioxole |
| IUPAC Name | 5-(isocyanatomethyl)-1,3-benzodioxole |
| Synonym | (1,3-Benzodioxol-5-yl)methyl isocyanate, 3,4-(Methylenedioxy)benzyl isocyanate |
| InChI | InChI=1S/C9H7NO3/c11-5-10-4-7-1-2-8-9(3-7)13-6-12-8/h1-3H,4,6H2 |
| InChIKey | RIUNOJGBBOBVDE-UHFFFAOYSA-N |
| SMILES | O=C=NCc1ccc2OCOc2c1 |
| MDL Number | MFCD08435909 |
Specification
| MW | 177.16 |
| MF | C9H7NO3 |
| Assay | >97% |
| Product Notes | May form small amount of sediment |
| Cat Number | OR9204 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
