CAS: 68808-54-8 | 3-Amino-1,4-dimethyl-5H-pyrido[4,3-b]indole acetate, NX58291
SKU: NX58291-5MG
![CAS: 68808-54-8 | 3-Amino-1,4-dimethyl-5H-pyrido[4,3-b]indole acetate, NX58291](http://www.innexscientific.com/cdn/shop/products/png_42e9255e-6240-439d-90a0-5367faf66311_{width}x.png?v=1622617958)
Product Identifiers
| Catalog # | NX58291 |
| CAS Number | 68808-54-8 |
| PubChem CID | 5284473 |
| Chemical Name | 3-Amino-1,4-dimethyl-5H-pyrido[4,3-b]indole acetate |
| IUPAC Name | acetic acid;1,4-dimethyl-5H-pyrido[4,3-b]indol-3-amine |
| Synonym | TRP-P-1, acetate |
| InChI | InChI=1S/C13H13N3.C2H4O2/c1-7-12-11(8(2)15-13(7)14)9-5-3-4-6-10(9)16-12;1-2(3)4/h3-6,16H,1-2H3,(H2,14,15);1H3,(H,3,4) |
| InChIKey | UXNRBAJNAWIPGF-UHFFFAOYSA-N |
| SMILES | CC(=O)O.Cc1nc(N)c(C)c2[nH]c3ccccc3c12 |
| MDL Number | MFCD00210369 |
Specification
| MW | 271.31 |
| MF | C15H17N3O2 |
| Product Notes | Investigations have shown that broiled fish, fried beef, commercial beef extracts and protein pyrolysates contain Trp which is highly mutagenic in the Ames Assay. |
| Cat Number | OR0750T |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
