CAS: 67-20-9 | Nitrofurantoin, NX57608
SKU: NX57608-100G
Product Identifiers
Catalog # | NX57608 |
CAS Number | 67-20-9 |
EC Numberr | 200-646-5 |
PubChem CID | 6604200 |
Chemical Name | Nitrofurantoin |
IUPAC Name | 1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione |
Synonym | N-(5-Nitro-2-furfurylidene)-1-aminohydantoin |
InChI | InChI=1S/C8H6N4O5/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16/h1-3H,4H2,(H,10,13,14)/b9-3+ |
InChIKey | NXFQHRVNIOXGAQ-YCRREMRBSA-N |
SMILES | [O-][N+](=O)c1oc(\C=N\N2CC(=O)NC2=O)cc1 |
MDL Number | MFCD00003224 |
Specification
MW | 238.16 |
MF | C8H6N4O5 |
Product Notes | Nitrofurantoin is bactericidal in vitro to most gram-positive and gram-negative bacteria |
Cat Number | BIN0136 |
Manufacturer | Apollo Scientific |
Country of Origin | United Kingdom |