CAS: 668-45-1 | 2-Chloro-6-fluorobenzonitrile, >98%, NX57549
SKU: NX57549-25G
Product Identifiers
| Catalog # | NX57549 |
| CAS Number | 668-45-1 |
| EC Numberr | 211-571-2 |
| PubChem CID | 69587 |
| Chemical Name | 2-Chloro-6-fluorobenzonitrile |
| IUPAC Name | 2-chloro-6-fluorobenzonitrile |
| InChI | InChI=1S/C7H3ClFN/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
| InChIKey | XPTAYRHLHAFUOS-UHFFFAOYSA-N |
| SMILES | Fc1cccc(Cl)c1C#N |
| MDL Number | MFCD00001780 |
Specification
| MW | 155.55 |
| MF | C7H3ClFN |
| Assay | >98% |
| Product Notes | Treatment with nucleophiles e.g alkoxides can selectively displace the fluorine atom: Synth. Commun., 621 (1984) |
| Cat Number | PC1863 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
