CAS: 63212-53-3 | 2-Chloro-3-ethylbenzoxazolium tetrafluoroborate, >97%, NX56107
SKU: NX56107-5G
Product Identifiers
| Catalog # | NX56107 |
| CAS Number | 63212-53-3 |
| EC Numberr | 263-998-9 |
| PubChem CID | 2724240 |
| Chemical Name | 2-Chloro-3-ethylbenzoxazolium tetrafluoroborate |
| IUPAC Name | 2-chloro-3-ethyl-1,3-benzoxazol-3-ium;tetrafluoroborate |
| InChI | InChI=1S/C9H9ClNO.BF4/c1-2-11-7-5-3-4-6-8(7)12-9(11)10;2-1(3,4)5/h3-6H,2H2,1H3;/q+1;-1 |
| InChIKey | MLQZANYFUYLJRK-UHFFFAOYSA-N |
| SMILES | CC[n+]1c(Cl)oc2ccccc12.F[B-](F)(F)F |
| MDL Number | MFCD00011943 |
Specification
| MW | 269.43 |
| MF | C9H9BClF4NO |
| Assay | >97% |
| Product Notes | Mild reagent which is able to activate alcohols to nucleophiles: Chem Lett., 383 (1997). Can act as a gentle reducing agent in the presence of base. |
| Cat Number | PC0062 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
