CAS: 58656-98-7 | tert-Butyl 4-fluorobenzoate, >97%, NX53897
SKU: NX53897-1G
Product Identifiers
| Catalog # | NX53897 |
| CAS Number | 58656-98-7 |
| PubChem CID | 2736444 |
| Chemical Name | tert-Butyl 4-fluorobenzoate |
| IUPAC Name | tert-butyl 4-fluorobenzoate |
| InChI | InChI=1S/C11H13FO2/c1-11(2,3)14-10(13)8-4-6-9(12)7-5-8/h4-7H,1-3H3 |
| InChIKey | ZZLARVGXLOCKHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1ccc(F)cc1 |
| MDL Number | MFCD01320759 |
Specification
| MW | 196.22 |
| MF | C11H13FO2 |
| Assay | >97% |
| Product Notes | Susceptible to nucleophilic aromatic substitution of fluorine by aliphatic amines: Synlett, 803 (1991).Enquire for other t-butyl esters. |
| Cat Number | PC9850 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
