Product Identifiers
Catalog # | NX25342 |
CAS Number | 1493-27-2 |
EC Numberr | 216-088-0 |
PubChem CID | 73895 |
Chemical Name | 2-Fluoronitrobenzene |
IUPAC Name | 1-fluoro-2-nitrobenzene |
Synonym | 1-Fluoro-2-nitrobenzene |
InChI | InChI=1S/C6H4FNO2/c7-5-3-1-2-4-6(5)8(9)10/h1-4H |
InChIKey | PWKNBLFSJAVFAB-UHFFFAOYSA-N |
SMILES | [O-][N+](=O)c1ccccc1F |
MDL Number | MFCD00007048 |
Specification
MW | 141.1 |
MF | C6H4FNO2 |
Assay | >98% |
Product Notes | The activated fluorine reacts with arylamines to form 2-nitrodiarylamines see: Synthesis, 215 (1980) |
Cat Number | PC3890 |
Manufacturer | Apollo Scientific |
Country of Origin | United Kingdom |