CAS: 851960-91-3 | L-Photo-Leucine, NX64110
SKU: NX64110-100MG
Product Identifiers
| Catalog # | NX64110 |
| CAS Number | 851960-91-3 |
| PubChem CID | 24998139 |
| Chemical Name | L-Photo-Leucine |
| IUPAC Name | (2S)-2-amino-3-(3-methyldiazirin-3-yl)propanoic acid |
| InChI | InChI=1S/C5H9N3O2/c1-5(7-8-5)2-3(6)4(9)10/h3H,2,6H2,1H3,(H,9,10)/t3-/m0/s1 |
| InChIKey | MJRDGTVDJKACQZ-VKHMYHEASA-N |
| SMILES | CC1(C[C@H](N)C(=O)O)N=N1 |
| MDL Number | MFCD19207670 |
Specification
| MW | 143.14 |
| MF | C5H9N3O2 |
| Product Notes | Analog of l-leucine which has photo-reactivity, this makes it suitable for observing and characterizing protein-protein interactions. |
| Special Remarks | Store at -20¡C |
| Cat Number | BIMI4532 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
