CAS: 2421187-96-2 | H-L-Photo-Leucine HCl, NX37040
SKU: NX37040-100MG
Product Identifiers
| Catalog # | NX37040 |
| CAS Number | 2421187-96-2 |
| PubChem CID | 145707368 |
| Chemical Name | H-L-Photo-Leucine HCl |
| IUPAC Name | (2S)-2-amino-3-(3-methyldiazirin-3-yl)propanoic acid;hydrochloride |
| InChI | InChI=1S/C5H9N3O2.ClH/c1-5(7-8-5)2-3(6)4(9)10;/h3H,2,6H2,1H3,(H,9,10);1H/t3-;/m0./s1 |
| InChIKey | ZKNFORQFTSETKL-DFWYDOINSA-N |
| SMILES | Cl.CC1(C[C@H](N)C(=O)O)N=N1 |
| MDL Number | MFCD31657154 |
Specification
| MW | 179.6 |
| MF | C5H10ClN3O2 |
| Product Notes | Analog of l-leucine which has photo-reactivity, this makes it suitable for observing and characterizing protein-protein interactions. |
| Special Remarks | Store at -20¡C |
| Cat Number | BIMI4533 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
