CAS: 1360651-24-6 | Fmoc-L-Photo-Leucine, NX22224
SKU: NX22224-50MG
Product Identifiers
| Catalog # | NX22224 |
| CAS Number | 1360651-24-6 |
| PubChem CID | 66807064 |
| Chemical Name | Fmoc-L-Photo-Leucine |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-methyldiazirin-3-yl)propanoic acid |
| InChI | InChI=1S/C20H19N3O4/c1-20(22-23-20)10-17(18(24)25)21-19(26)27-11-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16-17H,10-11H2,1H3,(H,21,26)(H,24,25)/t17-/m0/s1 |
| InChIKey | GDWMJFRPAHGSDU-KRWDZBQOSA-N |
| SMILES | CC1(C[C@H](NC(=O)OCC2c3ccccc3c4ccccc24)C(=O)O)N=N1 |
| MDL Number | MFCD31380715 |
Specification
| MW | 365.4 |
| MF | C20H19N3O4 |
| Product Notes | Analog of l-leucine which has photo-reactivity, this makes it suitable for observing and characterizing protein-protein interactions. |
| Special Remarks | Store at 2-8¡C |
| Cat Number | BIMI4534 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
