CAS: 1652591-81-5 | GSK484, >98%, NX27786
SKU: NX27786-5MG
Product Identifiers
| Catalog # | NX27786 |
| CAS Number | 1652591-81-5 |
| PubChem CID | 86340151 |
| Chemical Name | GSK484 |
| IUPAC Name | [(3S,4R)-3-amino-4-hydroxypiperidin-1-yl]-[2-[1-(cyclopropylmethyl)indol-2-yl]-7-methoxy-1-methylbenzimidazol-5-yl]methanone;hydrochloride |
| Synonym | PAD4 inhibitor |
| InChI | InChI=1S/C27H31N5O3.ClH/c1-30-25-20(11-18(13-24(25)35-2)27(34)31-10-9-23(33)19(28)15-31)29-26(30)22-12-17-5-3-4-6-21(17)32(22)14-16-7-8-16;/h3-6,11-13,16,19,23,33H,7-10,14-15,28H2,1-2H3;1H/t19-,23+;/m0./s1 |
| InChIKey | MULKOGJHUZTANI-ADMBKAPUSA-N |
| SMILES | Cl.COc1cc(cc2nc(c3cc4ccccc4n3CC5CC5)n(C)c12)C(=O)N6CC[C@@H](O)[C@@H](N)C6 |
| MDL Number | MFCD30343874 |
Specification
| MW | 510 |
| MF | C27H32ClN5O3 |
| Assay | >98% |
| Product Notes | GSK484 is a reversible and selective inhibitor of PAD4 with IC50 of 50 nM. GSK484 blocks the citrullination of PAD4 target proteins in human neutrophils and inhibits the formation of neutrophil extracellular traps in both mouse and human neutrophils. |
| Cat Number | BISN0052 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
