CAS: 1313613-09-0 | AMZ30, >99%, NX20771
SKU: NX20771-5MG
Product Identifiers
| Catalog # | NX20771 |
| CAS Number | 1313613-09-0 |
| PubChem CID | 44607965 |
| Chemical Name | AMZ30 |
| IUPAC Name | (E)-2-(4-fluorophenyl)sulfonyl-3-[1-(3-nitrophenyl)sulfonylpyrrol-2-yl]prop-2-enenitrile |
| InChI | InChI=1S/C19H12FN3O6S2/c20-14-6-8-17(9-7-14)30(26,27)19(13-21)11-15-4-2-10-22(15)31(28,29)18-5-1-3-16(12-18)23(24)25/h1-12H/b19-11+ |
| InChIKey | GUCUORSUHTZMBW-YBFXNURJSA-N |
| SMILES | [O-][N+](=O)c1cccc(c1)S(=O)(=O)n2cccc2\C=C(/C#N)\S(=O)(=O)c3ccc(F)cc3 |
| MDL Number | MFCD28900741 |
Specification
| MW | 461.4 |
| MF | C19H12FN3O6S2 |
| Assay | >99% |
| Product Notes | AMZ30 is a selective, covalent inhibitors of protein phosphatase methylesterase-1 (PME-1; IC50=600 nM), and selectively inactivates PME-1 and reduces the demethylated form of PP2A in living cells. |
| Special Remarks | Keep Cold |
| Cat Number | BISN0024 |
| Manufacturer | Apollo Scientific |
| Country of Origin | United Kingdom |
